C13H11Cl3IN3 — CID 107604767
3,5-dichloro-6-N-(2-chloro-4-iodophenyl)-2-N-ethylpyridine-2,6-diamine (PubChem CID 107604767) has the molecular formula C13H11Cl3IN3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(2-chloro-4-iodophenyl)-2-N-ethylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(2-chloro-4-iodophenyl)-2-N-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 107604767 |
| Molecular Formula | C13H11Cl3IN3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 440.91 |
| IUPAC Name | 3,5-dichloro-6-N-(2-chloro-4-iodophenyl)-2-N-ethylpyridine-2,6-diamine |
| SMILES | CCNc1nc(Nc2ccc(I)cc2Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3IN3/c1-2-18-12-9(15)6-10(16)13(20-12)19-11-4-3-7(17)5-8(11)14/h3-6H,2H2,1H3,(H2,18,19,20) |
| InChIKey | GKMRTVVEFJNHLZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|