C13H13Cl2IN4 — CID 107604713
5-chloro-4-N-(2-chloro-4-iodophenyl)-2-N-propylpyrimidine-2,4-diamine (PubChem CID 107604713) has the molecular formula C13H13Cl2IN4 and a molecular weight of 423.09 g/mol. Its IUPAC name is 5-chloro-4-N-(2-chloro-4-iodophenyl)-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-chloro-4-iodophenyl)-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 107604713 |
| Molecular Formula | C13H13Cl2IN4 |
| Molecular Weight | 423.09 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | 5-chloro-4-N-(2-chloro-4-iodophenyl)-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1ncc(Cl)c(Nc2ccc(I)cc2Cl)n1 |
| InChI | InChI=1S/C13H13Cl2IN4/c1-2-5-17-13-18-7-10(15)12(20-13)19-11-4-3-8(16)6-9(11)14/h3-4,6-7H,2,5H2,1H3,(H2,17,18,19,20) |
| InChIKey | SOYUWIIXSIGILF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.09 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|