About 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine
5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine (PubChem CID 104728637) has the molecular formula C14H15Cl3N4
and a molecular weight of 345.66 g/mol. Its IUPAC name is 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine |
| PubChem CID | 104728637 |
| Molecular Formula | C14H15Cl3N4 |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1ncc(Cl)c(Nc2cc(Cl)c(C)cc2Cl)n1 |
| InChI | InChI=1S/C14H15Cl3N4/c1-3-4-18-14-19-7-11(17)13(21-14)20-12-6-9(15)8(2)5-10(12)16/h5-7H,3-4H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | IBSVHTJDPHTXBH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine?
The IUPAC name of 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine (CID 104728637) is 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine?
The canonical SMILES for 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine is CCCNc1ncc(Cl)c(Nc2cc(Cl)c(C)cc2Cl)n1.
What is the InChIKey of 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine?
The InChIKey is IBSVHTJDPHTXBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl3N4/c1-3-4-18-14-19-7-11(17)13(21-14)20-12-6-9(15)8(2)5-10(12)16/h5-7H,3-4H2,1-2H3,(H2,18,19,20,21).
What are the key properties of 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine?
5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine has a molecular weight of 345.66 g/mol, XLogP of 5.31, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-N-(2,5-dichloro-4-methylphenyl)-2-N-propylpyrimidine-2,4-diamine is sourced from PubChem (CID 104728637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).