C14H8ClF2N3 — CID 157044809
7-chloro-5-(2,4-difluorophenyl)-2-methylpyrido[3,4-b]pyrazine (PubChem CID 157044809) has the molecular formula C14H8ClF2N3 and a molecular weight of 291.69 g/mol. Its IUPAC name is 7-chloro-5-(2,4-difluorophenyl)-2-methylpyrido[3,4-b]pyrazine.
| Compound Name | 7-chloro-5-(2,4-difluorophenyl)-2-methylpyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 157044809 |
| Molecular Formula | C14H8ClF2N3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 7-chloro-5-(2,4-difluorophenyl)-2-methylpyrido[3,4-b]pyrazine |
| SMILES | Cc1cnc2c(-c3ccc(F)cc3F)nc(Cl)cc2n1 |
| InChI | InChI=1S/C14H8ClF2N3/c1-7-6-18-14-11(19-7)5-12(15)20-13(14)9-3-2-8(16)4-10(9)17/h2-6H,1H3 |
| InChIKey | RKOZCPYDPVYEGJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|