C16H13ClFN3 — CID 157045257
7-chloro-5-(2-fluoro-4-methylphenyl)-2,3-dimethylpyrido[3,4-b]pyrazine (PubChem CID 157045257) has the molecular formula C16H13ClFN3 and a molecular weight of 301.75 g/mol. Its IUPAC name is 7-chloro-5-(2-fluoro-4-methylphenyl)-2,3-dimethylpyrido[3,4-b]pyrazine.
| Compound Name | 7-chloro-5-(2-fluoro-4-methylphenyl)-2,3-dimethylpyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 157045257 |
| Molecular Formula | C16H13ClFN3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 7-chloro-5-(2-fluoro-4-methylphenyl)-2,3-dimethylpyrido[3,4-b]pyrazine |
| SMILES | Cc1ccc(-c2nc(Cl)cc3nc(C)c(C)nc23)c(F)c1 |
| InChI | InChI=1S/C16H13ClFN3/c1-8-4-5-11(12(18)6-8)15-16-13(7-14(17)21-15)19-9(2)10(3)20-16/h4-7H,1-3H3 |
| InChIKey | VACHVSCNORKMMR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|