C16H11ClF2N2 — CID 157045220
7-chloro-5-(2,4-difluorophenyl)-2,3-dimethyl-1,6-naphthyridine (PubChem CID 157045220) has the molecular formula C16H11ClF2N2 and a molecular weight of 304.73 g/mol. Its IUPAC name is 7-chloro-5-(2,4-difluorophenyl)-2,3-dimethyl-1,6-naphthyridine.
| Compound Name | 7-chloro-5-(2,4-difluorophenyl)-2,3-dimethyl-1,6-naphthyridine |
|---|---|
| PubChem CID | 157045220 |
| Molecular Formula | C16H11ClF2N2 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 7-chloro-5-(2,4-difluorophenyl)-2,3-dimethyl-1,6-naphthyridine |
| SMILES | Cc1cc2c(-c3ccc(F)cc3F)nc(Cl)cc2nc1C |
| InChI | InChI=1S/C16H11ClF2N2/c1-8-5-12-14(20-9(8)2)7-15(17)21-16(12)11-4-3-10(18)6-13(11)19/h3-7H,1-2H3 |
| InChIKey | OHBLWWYABTWJQH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|