C29H34ClFN6O3 — CID 177151831
13-(4-chloro-2-fluorophenyl)-11-morpholin-4-yl-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one;(Z)-3-[3-(methoxymethyl)cyclobutyl]iminoprop-1-en-1-amine (PubChem CID 177151831) has the molecular formula C29H34ClFN6O3 and a molecular weight of 569.08 g/mol. Its IUPAC name is 13-(4-chloro-2-fluorophenyl)-11-morpholin-4-yl-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one;(Z)-3-[3-(methoxymethyl)cyclobutyl]iminoprop-1-en-1-amine.
| Compound Name | 13-(4-chloro-2-fluorophenyl)-11-morpholin-4-yl-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one;(Z)-3-[3-(methoxymethyl)cyclobutyl]iminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 177151831 |
| Molecular Formula | C29H34ClFN6O3 |
| Molecular Weight | 569.08 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 13-(4-chloro-2-fluorophenyl)-11-morpholin-4-yl-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one;(Z)-3-[3-(methoxymethyl)cyclobutyl]iminoprop-1-en-1-amine |
| SMILES | COCC1CC(/N=C/C=C\N)C1.O=c1c2cc(N3CCOCC3)nc(-c3ccc(Cl)cc3F)c2nc2n1CCC2 |
| InChI | InChI=1S/C20H18ClFN4O2.C9H16N2O/c21-12-3-4-13(15(22)10-12)18-19-14(20(27)26-5-1-2-16(26)23-19)11-17(24-18)25-6-8-28-9-7-25;1-12-7-8-5-9(6-8)11-4-2-3-10/h3-4,10-11H,1-2,5-9H2;2-4,8-9H,5-7,10H2,1H3/b;3-2-,11-4+ |
| InChIKey | CJUDKTAZBNDOIF-YMWQTKMISA-N |
| XLogP | 3.99 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.08 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|