C27H28ClFN6O2 — CID 177151779
11-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]-6-methylmorpholin-4-yl]-13-(4-chloro-2-fluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one (PubChem CID 177151779) has the molecular formula C27H28ClFN6O2 and a molecular weight of 523.01 g/mol. Its IUPAC name is 11-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]-6-methylmorpholin-4-yl]-13-(4-chloro-2-fluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one.
| Compound Name | 11-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]-6-methylmorpholin-4-yl]-13-(4-chloro-2-fluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 177151779 |
| Molecular Formula | C27H28ClFN6O2 |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 11-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]-6-methylmorpholin-4-yl]-13-(4-chloro-2-fluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
| SMILES | CC1CN(c2cc3c(=O)n4c(nc3c(-c3ccc(Cl)cc3F)n2)CCC4)CC(C(/C=N/C2CC2)=C/N)O1 |
| InChI | InChI=1S/C27H28ClFN6O2/c1-15-13-34(14-22(37-15)16(11-30)12-31-18-5-6-18)24-10-20-26(32-23-3-2-8-35(23)27(20)36)25(33-24)19-7-4-17(28)9-21(19)29/h4,7,9-12,15,18,22H,2-3,5-6,8,13-14,30H2,1H3/b16-11+,31-12+ |
| InChIKey | DOERMLUIEKPABL-AKTVXUOASA-N |
| XLogP | 3.87 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|