C28H29ClFN5O2 — CID 177152061
11-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]-6-methyloxan-4-yl]-13-(4-chloro-2-fluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one (PubChem CID 177152061) has the molecular formula C28H29ClFN5O2 and a molecular weight of 522.02 g/mol. Its IUPAC name is 11-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]-6-methyloxan-4-yl]-13-(4-chloro-2-fluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one.
| Compound Name | 11-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]-6-methyloxan-4-yl]-13-(4-chloro-2-fluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 177152061 |
| Molecular Formula | C28H29ClFN5O2 |
| Molecular Weight | 522.02 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 11-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]-6-methyloxan-4-yl]-13-(4-chloro-2-fluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
| SMILES | CC1CC(c2cc3c(=O)n4c(nc3c(-c3ccc(Cl)cc3F)n2)CCC4)CC(C(/C=N/C2CC2)=C/N)O1 |
| InChI | InChI=1S/C28H29ClFN5O2/c1-15-9-16(10-24(37-15)17(13-31)14-32-19-5-6-19)23-12-21-27(34-25-3-2-8-35(25)28(21)36)26(33-23)20-7-4-18(29)11-22(20)30/h4,7,11-16,19,24H,2-3,5-6,8-10,31H2,1H3/b17-13+,32-14+ |
| InChIKey | SSGBANHQFGFVHD-FSNWLOOISA-N |
| XLogP | 4.92 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.02 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|