C27H28ClF2N3O3 — CID 177151824
13-(4-chloro-2,3-difluorophenyl)-11-[2-(2,2-dimethyloxolan-3-yl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one (PubChem CID 177151824) has the molecular formula C27H28ClF2N3O3 and a molecular weight of 515.99 g/mol. Its IUPAC name is 13-(4-chloro-2,3-difluorophenyl)-11-[2-(2,2-dimethyloxolan-3-yl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one.
| Compound Name | 13-(4-chloro-2,3-difluorophenyl)-11-[2-(2,2-dimethyloxolan-3-yl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 177151824 |
| Molecular Formula | C27H28ClF2N3O3 |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 13-(4-chloro-2,3-difluorophenyl)-11-[2-(2,2-dimethyloxolan-3-yl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
| SMILES | CC1(C)OCCC1C1CC(c2cc3c(=O)n4c(nc3c(-c3ccc(Cl)c(F)c3F)n2)CCC4)CCO1 |
| InChI | InChI=1S/C27H28ClF2N3O3/c1-27(2)17(8-11-36-27)20-12-14(7-10-35-20)19-13-16-25(32-21-4-3-9-33(21)26(16)34)24(31-19)15-5-6-18(28)23(30)22(15)29/h5-6,13-14,17,20H,3-4,7-12H2,1-2H3 |
| InChIKey | APHGSJAHDUGJKC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|