C26H21ClF2N4O3 — CID 177152361
10-(4-chloro-2,3-difluorophenyl)-12-[2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one (PubChem CID 177152361) has the molecular formula C26H21ClF2N4O3 and a molecular weight of 510.93 g/mol. Its IUPAC name is 10-(4-chloro-2,3-difluorophenyl)-12-[2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one.
| Compound Name | 10-(4-chloro-2,3-difluorophenyl)-12-[2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 177152361 |
| Molecular Formula | C26H21ClF2N4O3 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 10-(4-chloro-2,3-difluorophenyl)-12-[2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
| SMILES | Cc1cc(C2CC(c3cn4c(=O)c5c(nc4c(-c4ccc(Cl)c(F)c4F)n3)COC5)CCO2)ccn1 |
| InChI | InChI=1S/C26H21ClF2N4O3/c1-13-8-15(4-6-30-13)21-9-14(5-7-36-21)19-10-33-25(32-20-12-35-11-17(20)26(33)34)24(31-19)16-2-3-18(27)23(29)22(16)28/h2-4,6,8,10,14,21H,5,7,9,11-12H2,1H3 |
| InChIKey | LEUUIAHGXUJAMM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|