C26H20F4N4O3 — CID 177152010
12-[2-[2-(difluoromethyl)-4-pyridinyl]oxan-4-yl]-10-(2,4-difluorophenyl)-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one (PubChem CID 177152010) has the molecular formula C26H20F4N4O3 and a molecular weight of 512.46 g/mol. Its IUPAC name is 12-[2-[2-(difluoromethyl)-4-pyridinyl]oxan-4-yl]-10-(2,4-difluorophenyl)-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one.
| Compound Name | 12-[2-[2-(difluoromethyl)-4-pyridinyl]oxan-4-yl]-10-(2,4-difluorophenyl)-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 177152010 |
| Molecular Formula | C26H20F4N4O3 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 12-[2-[2-(difluoromethyl)-4-pyridinyl]oxan-4-yl]-10-(2,4-difluorophenyl)-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
| SMILES | O=c1c2c(nc3c(-c4ccc(F)cc4F)nc(C4CCOC(c5ccnc(C(F)F)c5)C4)cn13)COC2 |
| InChI | InChI=1S/C26H20F4N4O3/c27-15-1-2-16(18(28)9-15)23-25-33-21-12-36-11-17(21)26(35)34(25)10-20(32-23)13-4-6-37-22(8-13)14-3-5-31-19(7-14)24(29)30/h1-3,5,7,9-10,13,22,24H,4,6,8,11-12H2 |
| InChIKey | VYNNZZOXOFKQJY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |