C27H24F2N4O3 — CID 177152122
10-(2,4-difluorophenyl)-6-methyl-12-[(2R,4S)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one (PubChem CID 177152122) has the molecular formula C27H24F2N4O3 and a molecular weight of 490.51 g/mol. Its IUPAC name is 10-(2,4-difluorophenyl)-6-methyl-12-[(2R,4S)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one.
| Compound Name | 10-(2,4-difluorophenyl)-6-methyl-12-[(2R,4S)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 177152122 |
| Molecular Formula | C27H24F2N4O3 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 10-(2,4-difluorophenyl)-6-methyl-12-[(2R,4S)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
| SMILES | Cc1cc([C@H]2C[C@@H](c3cn4c(=O)c5c(nc4c(-c4ccc(F)cc4F)n3)C(C)OC5)CCO2)ccn1 |
| InChI | InChI=1S/C27H24F2N4O3/c1-14-9-17(5-7-30-14)23-10-16(6-8-35-23)22-12-33-26(32-24-15(2)36-13-20(24)27(33)34)25(31-22)19-4-3-18(28)11-21(19)29/h3-5,7,9,11-12,15-16,23H,6,8,10,13H2,1-2H3/t15?,16-,23+/m0/s1 |
| InChIKey | BMWYTTQCTXVUCA-JIDNQSRCSA-N |
| XLogP | 4.96 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |