C26H22F2N4O3 — CID 177151435
13-(2,4-difluorophenyl)-11-[(2R,4S)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,12-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one (PubChem CID 177151435) has the molecular formula C26H22F2N4O3 and a molecular weight of 476.48 g/mol. Its IUPAC name is 13-(2,4-difluorophenyl)-11-[(2R,4S)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,12-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one.
| Compound Name | 13-(2,4-difluorophenyl)-11-[(2R,4S)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,12-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 177151435 |
| Molecular Formula | C26H22F2N4O3 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 13-(2,4-difluorophenyl)-11-[(2R,4S)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-5-oxa-1,8,12-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
| SMILES | Cc1cc([C@H]2C[C@@H](c3cc4nc5c(c(=O)n4c(-c4ccc(F)cc4F)n3)COC5)CCO2)ccn1 |
| InChI | InChI=1S/C26H22F2N4O3/c1-14-8-16(4-6-29-14)23-9-15(5-7-35-23)21-11-24-30-22-13-34-12-19(22)26(33)32(24)25(31-21)18-3-2-17(27)10-20(18)28/h2-4,6,8,10-11,15,23H,5,7,9,12-13H2,1H3/t15-,23+/m0/s1 |
| InChIKey | BJKAPSVTNZWMFY-NPMXOYFQSA-N |
| XLogP | 4.40 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |