C26H23F2N5O3 — CID 177152137
12-[2-(1-cyclopropylpyrazol-4-yl)oxan-4-yl]-10-(2,4-difluorophenyl)-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one (PubChem CID 177152137) has the molecular formula C26H23F2N5O3 and a molecular weight of 491.50 g/mol. Its IUPAC name is 12-[2-(1-cyclopropylpyrazol-4-yl)oxan-4-yl]-10-(2,4-difluorophenyl)-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one.
| Compound Name | 12-[2-(1-cyclopropylpyrazol-4-yl)oxan-4-yl]-10-(2,4-difluorophenyl)-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 177152137 |
| Molecular Formula | C26H23F2N5O3 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 12-[2-(1-cyclopropylpyrazol-4-yl)oxan-4-yl]-10-(2,4-difluorophenyl)-5-oxa-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
| SMILES | O=c1c2c(nc3c(-c4ccc(F)cc4F)nc(C4CCOC(c5cnn(C6CC6)c5)C4)cn13)COC2 |
| InChI | InChI=1S/C26H23F2N5O3/c27-16-1-4-18(20(28)8-16)24-25-31-22-13-35-12-19(22)26(34)32(25)11-21(30-24)14-5-6-36-23(7-14)15-9-29-33(10-15)17-2-3-17/h1,4,8-11,14,17,23H,2-3,5-7,12-13H2 |
| InChIKey | MZGRLYZUBPIYOO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |