C26H23ClFN5O2 — CID 177151970
13-(4-chloro-2-fluorophenyl)-11-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one (PubChem CID 177151970) has the molecular formula C26H23ClFN5O2 and a molecular weight of 491.95 g/mol. Its IUPAC name is 13-(4-chloro-2-fluorophenyl)-11-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one.
| Compound Name | 13-(4-chloro-2-fluorophenyl)-11-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 177151970 |
| Molecular Formula | C26H23ClFN5O2 |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 13-(4-chloro-2-fluorophenyl)-11-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
| SMILES | Cc1cc([C@@H]2CN(c3cc4c(=O)n5c(nc4c(-c4ccc(Cl)cc4F)n3)CCC5)CCO2)ccn1 |
| InChI | InChI=1S/C26H23ClFN5O2/c1-15-11-16(6-7-29-15)21-14-32(9-10-35-21)23-13-19-25(30-22-3-2-8-33(22)26(19)34)24(31-23)18-5-4-17(27)12-20(18)28/h4-7,11-13,21H,2-3,8-10,14H2,1H3/t21-/m0/s1 |
| InChIKey | TYIVGWWIVXILIG-NRFANRHFSA-N |
| XLogP | 4.48 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |