C28H26F2N4O2 — CID 177151909
13-(2,4-difluorophenyl)-11-[(2R)-2-methyl-6-(2-methyl-4-pyridinyl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one (PubChem CID 177151909) has the molecular formula C28H26F2N4O2 and a molecular weight of 488.54 g/mol. Its IUPAC name is 13-(2,4-difluorophenyl)-11-[(2R)-2-methyl-6-(2-methyl-4-pyridinyl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one.
| Compound Name | 13-(2,4-difluorophenyl)-11-[(2R)-2-methyl-6-(2-methyl-4-pyridinyl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 177151909 |
| Molecular Formula | C28H26F2N4O2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 13-(2,4-difluorophenyl)-11-[(2R)-2-methyl-6-(2-methyl-4-pyridinyl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
| SMILES | Cc1cc(C2CC(c3cc4c(=O)n5c(nc4c(-c4ccc(F)cc4F)n3)CCC5)C[C@@H](C)O2)ccn1 |
| InChI | InChI=1S/C28H26F2N4O2/c1-15-10-17(7-8-31-15)24-12-18(11-16(2)36-24)23-14-21-27(33-25-4-3-9-34(25)28(21)35)26(32-23)20-6-5-19(29)13-22(20)30/h5-8,10,13-14,16,18,24H,3-4,9,11-12H2,1-2H3/t16-,18?,24?/m1/s1 |
| InChIKey | TVZKCVJLRFCXQA-HKYQFSCDSA-N |
| XLogP | 5.41 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |