C26H23F2N5O3 — CID 177152368
13-(2,4-difluorophenyl)-11-[(3R)-3-[(2-methoxy-4-pyridinyl)oxy]pyrrolidin-1-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one (PubChem CID 177152368) has the molecular formula C26H23F2N5O3 and a molecular weight of 491.50 g/mol. Its IUPAC name is 13-(2,4-difluorophenyl)-11-[(3R)-3-[(2-methoxy-4-pyridinyl)oxy]pyrrolidin-1-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one.
| Compound Name | 13-(2,4-difluorophenyl)-11-[(3R)-3-[(2-methoxy-4-pyridinyl)oxy]pyrrolidin-1-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 177152368 |
| Molecular Formula | C26H23F2N5O3 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 13-(2,4-difluorophenyl)-11-[(3R)-3-[(2-methoxy-4-pyridinyl)oxy]pyrrolidin-1-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
| SMILES | COc1cc(O[C@@H]2CCN(c3cc4c(=O)n5c(nc4c(-c4ccc(F)cc4F)n3)CCC5)C2)ccn1 |
| InChI | InChI=1S/C26H23F2N5O3/c1-35-23-12-16(6-8-29-23)36-17-7-10-32(14-17)22-13-19-25(30-21-3-2-9-33(21)26(19)34)24(31-22)18-5-4-15(27)11-20(18)28/h4-6,8,11-13,17H,2-3,7,9-10,14H2,1H3/t17-/m1/s1 |
| InChIKey | UDXDHTKOOVRJFV-QGZVFWFLSA-N |
| XLogP | 3.74 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |