C24H23F3N6O2 — CID 177152020
11-[2-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]morpholin-4-yl]-13-(2,4,5-trifluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one (PubChem CID 177152020) has the molecular formula C24H23F3N6O2 and a molecular weight of 484.48 g/mol. Its IUPAC name is 11-[2-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]morpholin-4-yl]-13-(2,4,5-trifluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one.
| Compound Name | 11-[2-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]morpholin-4-yl]-13-(2,4,5-trifluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 177152020 |
| Molecular Formula | C24H23F3N6O2 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 11-[2-[(E)-1-amino-3-methyliminoprop-1-en-2-yl]morpholin-4-yl]-13-(2,4,5-trifluorophenyl)-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,9,11-tetraen-8-one |
| SMILES | C/N=C/C(=C\N)C1CN(c2cc3c(=O)n4c(nc3c(-c3cc(F)c(F)cc3F)n2)CCC4)CCO1 |
| InChI | InChI=1S/C24H23F3N6O2/c1-29-11-13(10-28)19-12-32(5-6-35-19)21-8-15-23(30-20-3-2-4-33(20)24(15)34)22(31-21)14-7-17(26)18(27)9-16(14)25/h7-11,19H,2-6,12,28H2,1H3/b13-10+,29-11+ |
| InChIKey | MLIOKACVDYEEBC-VZVNWCBKSA-N |
| XLogP | 2.57 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|