C27H30ClFN6O2 — CID 177152157
7-(4-chloro-2-fluorophenyl)-5-morpholin-4-yl-1,6,9-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7,9-tetraen-2-one;(Z)-3-cyclopropyliminoprop-1-en-1-amine (PubChem CID 177152157) has the molecular formula C27H30ClFN6O2 and a molecular weight of 525.03 g/mol. Its IUPAC name is 7-(4-chloro-2-fluorophenyl)-5-morpholin-4-yl-1,6,9-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7,9-tetraen-2-one;(Z)-3-cyclopropyliminoprop-1-en-1-amine.
| Compound Name | 7-(4-chloro-2-fluorophenyl)-5-morpholin-4-yl-1,6,9-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7,9-tetraen-2-one;(Z)-3-cyclopropyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 177152157 |
| Molecular Formula | C27H30ClFN6O2 |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 7-(4-chloro-2-fluorophenyl)-5-morpholin-4-yl-1,6,9-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7,9-tetraen-2-one;(Z)-3-cyclopropyliminoprop-1-en-1-amine |
| SMILES | N/C=C\C=N\C1CC1.O=c1c2cc(N3CCOCC3)nc(-c3ccc(Cl)cc3F)c2nc2n1CCCC2 |
| InChI | InChI=1S/C21H20ClFN4O2.C6H10N2/c22-13-4-5-14(16(23)11-13)19-20-15(12-18(25-19)26-7-9-29-10-8-26)21(28)27-6-2-1-3-17(27)24-20;7-4-1-5-8-6-2-3-6/h4-5,11-12H,1-3,6-10H2;1,4-6H,2-3,7H2/b;4-1-,8-5+ |
| InChIKey | JHSZFABUHKKPSF-JKWLNEMPSA-N |
| XLogP | 4.12 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|