C21H22N4O2 — CID 177152212
13-[(2S,4R)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraen-8-one (PubChem CID 177152212) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 13-[(2S,4R)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraen-8-one.
| Compound Name | 13-[(2S,4R)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraen-8-one |
|---|---|
| PubChem CID | 177152212 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 13-[(2S,4R)-2-(2-methyl-4-pyridinyl)oxan-4-yl]-2,7,12-triazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraen-8-one |
| SMILES | Cc1cc([C@@H]2C[C@H](c3nccc4c(=O)n5c(nc34)CCC5)CCO2)ccn1 |
| InChI | InChI=1S/C21H22N4O2/c1-13-11-14(4-7-22-13)17-12-15(6-10-27-17)19-20-16(5-8-23-19)21(26)25-9-2-3-18(25)24-20/h4-5,7-8,11,15,17H,2-3,6,9-10,12H2,1H3/t15-,17+/m1/s1 |
| InChIKey | OVBIQFLDAVNTKZ-WBVHZDCISA-N |
| XLogP | 3.08 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |