C27H27ClFN5O2 — CID 177151896
12-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]oxan-4-yl]-10-(4-chloro-2-fluorophenyl)-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one (PubChem CID 177151896) has the molecular formula C27H27ClFN5O2 and a molecular weight of 508.00 g/mol. Its IUPAC name is 12-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]oxan-4-yl]-10-(4-chloro-2-fluorophenyl)-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one.
| Compound Name | 12-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]oxan-4-yl]-10-(4-chloro-2-fluorophenyl)-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 177151896 |
| Molecular Formula | C27H27ClFN5O2 |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 12-[2-[(E)-1-amino-3-cyclopropyliminoprop-1-en-2-yl]oxan-4-yl]-10-(4-chloro-2-fluorophenyl)-1,8,11-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraen-2-one |
| SMILES | N/C=C(\C=N\C1CC1)C1CC(c2cn3c(=O)c4c(nc3c(-c3ccc(Cl)cc3F)n2)CCC4)CCO1 |
| InChI | InChI=1S/C27H27ClFN5O2/c28-17-4-7-19(21(29)11-17)25-26-33-22-3-1-2-20(22)27(35)34(26)14-23(32-25)15-8-9-36-24(10-15)16(12-30)13-31-18-5-6-18/h4,7,11-15,18,24H,1-3,5-6,8-10,30H2/b16-12+,31-13+ |
| InChIKey | WYPXEYRWZNAAJV-RLVAGYQQSA-N |
| XLogP | 4.38 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|