C14H25N5O2 — CID 102989518
N-ethyl-4-morpholin-4-yl-6-pentan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 102989518) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is N-ethyl-4-morpholin-4-yl-6-pentan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-morpholin-4-yl-6-pentan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 102989518 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N-ethyl-4-morpholin-4-yl-6-pentan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | CCCC(C)Oc1nc(NCC)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C14H25N5O2/c1-4-6-11(3)21-14-17-12(15-5-2)16-13(18-14)19-7-9-20-10-8-19/h11H,4-10H2,1-3H3,(H,15,16,17,18) |
| InChIKey | RINOBEKWYQRGEK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |