C22H29N7O4S — CID 25255155
3-[9-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-2-morpholin-4-ylpurin-6-yl]phenol (PubChem CID 25255155) has the molecular formula C22H29N7O4S and a molecular weight of 487.59 g/mol. Its IUPAC name is 3-[9-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-2-morpholin-4-ylpurin-6-yl]phenol.
| Compound Name | 3-[9-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-2-morpholin-4-ylpurin-6-yl]phenol |
|---|---|
| PubChem CID | 25255155 |
| Molecular Formula | C22H29N7O4S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 3-[9-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-2-morpholin-4-ylpurin-6-yl]phenol |
| SMILES | CS(=O)(=O)N1CCN(CCn2cnc3c(-c4cccc(O)c4)nc(N4CCOCC4)nc32)CC1 |
| InChI | InChI=1S/C22H29N7O4S/c1-34(31,32)29-9-6-26(7-10-29)5-8-28-16-23-20-19(17-3-2-4-18(30)15-17)24-22(25-21(20)28)27-11-13-33-14-12-27/h2-4,15-16,30H,5-14H2,1H3 |
| InChIKey | IYIZFBZPZNGSBO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |