C18H20N6O3 — CID 90736300
3-[6-(3-hydroxyphenyl)-2-morpholin-4-ylpurin-9-yl]propanamide (PubChem CID 90736300) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is 3-[6-(3-hydroxyphenyl)-2-morpholin-4-ylpurin-9-yl]propanamide.
| Compound Name | 3-[6-(3-hydroxyphenyl)-2-morpholin-4-ylpurin-9-yl]propanamide |
|---|---|
| PubChem CID | 90736300 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-[6-(3-hydroxyphenyl)-2-morpholin-4-ylpurin-9-yl]propanamide |
| SMILES | NC(=O)CCn1cnc2c(-c3cccc(O)c3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C18H20N6O3/c19-14(26)4-5-24-11-20-16-15(12-2-1-3-13(25)10-12)21-18(22-17(16)24)23-6-8-27-9-7-23/h1-3,10-11,25H,4-9H2,(H2,19,26) |
| InChIKey | CUCXMVHUYNRMKK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |