C23H21F3N6O — CID 117084514
2-morpholin-4-yl-N-phenyl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 117084514) has the molecular formula C23H21F3N6O and a molecular weight of 454.46 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-phenyl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | 2-morpholin-4-yl-N-phenyl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 117084514 |
| Molecular Formula | C23H21F3N6O |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-morpholin-4-yl-N-phenyl-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | FC(F)(F)c1ccc(Cn2cnc3c(Nc4ccccc4)nc(N4CCOCC4)nc32)cc1 |
| InChI | InChI=1S/C23H21F3N6O/c24-23(25,26)17-8-6-16(7-9-17)14-32-15-27-19-20(28-18-4-2-1-3-5-18)29-22(30-21(19)32)31-10-12-33-13-11-31/h1-9,15H,10-14H2,(H,28,29,30) |
| InChIKey | XHVQHRRGGRRMLJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |