C33H39F3N8O2 — CID 117083961
N,N-diethyl-1-[6-(4-morpholin-4-ylanilino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-2-yl]piperidine-3-carboxamide (PubChem CID 117083961) has the molecular formula C33H39F3N8O2 and a molecular weight of 636.72 g/mol. Its IUPAC name is N,N-diethyl-1-[6-(4-morpholin-4-ylanilino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-2-yl]piperidine-3-carboxamide.
| Compound Name | N,N-diethyl-1-[6-(4-morpholin-4-ylanilino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 117083961 |
| Molecular Formula | C33H39F3N8O2 |
| Molecular Weight | 636.72 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | N,N-diethyl-1-[6-(4-morpholin-4-ylanilino)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-2-yl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(c2nc(Nc3ccc(N4CCOCC4)cc3)c3ncn(Cc4ccc(C(F)(F)F)cc4)c3n2)C1 |
| InChI | InChI=1S/C33H39F3N8O2/c1-3-41(4-2)31(45)24-6-5-15-43(21-24)32-39-29(38-26-11-13-27(14-12-26)42-16-18-46-19-17-42)28-30(40-32)44(22-37-28)20-23-7-9-25(10-8-23)33(34,35)36/h7-14,22,24H,3-6,15-21H2,1-2H3,(H,38,39,40) |
| InChIKey | OFWYTTPPXSJDPN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|