C30H37N7O4 — CID 117082399
N,N-diethyl-1-[9-phenyl-6-(3,4,5-trimethoxyanilino)purin-2-yl]piperidine-3-carboxamide (PubChem CID 117082399) has the molecular formula C30H37N7O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is N,N-diethyl-1-[9-phenyl-6-(3,4,5-trimethoxyanilino)purin-2-yl]piperidine-3-carboxamide.
| Compound Name | N,N-diethyl-1-[9-phenyl-6-(3,4,5-trimethoxyanilino)purin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 117082399 |
| Molecular Formula | C30H37N7O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | N,N-diethyl-1-[9-phenyl-6-(3,4,5-trimethoxyanilino)purin-2-yl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(c2nc(Nc3cc(OC)c(OC)c(OC)c3)c3ncn(-c4ccccc4)c3n2)C1 |
| InChI | InChI=1S/C30H37N7O4/c1-6-35(7-2)29(38)20-12-11-15-36(18-20)30-33-27(32-21-16-23(39-3)26(41-5)24(17-21)40-4)25-28(34-30)37(19-31-25)22-13-9-8-10-14-22/h8-10,13-14,16-17,19-20H,6-7,11-12,15,18H2,1-5H3,(H,32,33,34) |
| InChIKey | HYUNSHHBTOSDIL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |