C29H35N7O2 — CID 117085292
N,N-diethyl-1-[6-(2-phenoxyethylamino)-9-phenylpurin-2-yl]piperidine-3-carboxamide (PubChem CID 117085292) has the molecular formula C29H35N7O2 and a molecular weight of 513.65 g/mol. Its IUPAC name is N,N-diethyl-1-[6-(2-phenoxyethylamino)-9-phenylpurin-2-yl]piperidine-3-carboxamide.
| Compound Name | N,N-diethyl-1-[6-(2-phenoxyethylamino)-9-phenylpurin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 117085292 |
| Molecular Formula | C29H35N7O2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | N,N-diethyl-1-[6-(2-phenoxyethylamino)-9-phenylpurin-2-yl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(c2nc(NCCOc3ccccc3)c3ncn(-c4ccccc4)c3n2)C1 |
| InChI | InChI=1S/C29H35N7O2/c1-3-34(4-2)28(37)22-12-11-18-35(20-22)29-32-26(30-17-19-38-24-15-9-6-10-16-24)25-27(33-29)36(21-31-25)23-13-7-5-8-14-23/h5-10,13-16,21-22H,3-4,11-12,17-20H2,1-2H3,(H,30,32,33) |
| InChIKey | TUIFVITWSYPEFL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|