C27H31N7O — CID 117081648
1-(6-anilino-9-phenylpurin-2-yl)-N,N-diethylpiperidine-3-carboxamide (PubChem CID 117081648) has the molecular formula C27H31N7O and a molecular weight of 469.59 g/mol. Its IUPAC name is 1-(6-anilino-9-phenylpurin-2-yl)-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-(6-anilino-9-phenylpurin-2-yl)-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 117081648 |
| Molecular Formula | C27H31N7O |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 1-(6-anilino-9-phenylpurin-2-yl)-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(c2nc(Nc3ccccc3)c3ncn(-c4ccccc4)c3n2)C1 |
| InChI | InChI=1S/C27H31N7O/c1-3-32(4-2)26(35)20-12-11-17-33(18-20)27-30-24(29-21-13-7-5-8-14-21)23-25(31-27)34(19-28-23)22-15-9-6-10-16-22/h5-10,13-16,19-20H,3-4,11-12,17-18H2,1-2H3,(H,29,30,31) |
| InChIKey | HAFBCZVMKQNHSK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |