C16H23N3O3 — CID 7123107
(3R)-N,N-diethyl-1-(2-nitrophenyl)piperidine-3-carboxamide (PubChem CID 7123107) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3R)-N,N-diethyl-1-(2-nitrophenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N,N-diethyl-1-(2-nitrophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 7123107 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3R)-N,N-diethyl-1-(2-nitrophenyl)piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCCN(c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H23N3O3/c1-3-17(4-2)16(20)13-8-7-11-18(12-13)14-9-5-6-10-15(14)19(21)22/h5-6,9-10,13H,3-4,7-8,11-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | UDVDKLWQHCSBQO-CYBMUJFWSA-N |
| XLogP | 2.68 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|