C20H30N4O6S — CID 27002680
(3S)-N,N-diethyl-1-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)piperidine-3-carboxamide (PubChem CID 27002680) has the molecular formula C20H30N4O6S and a molecular weight of 454.55 g/mol. Its IUPAC name is (3S)-N,N-diethyl-1-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N,N-diethyl-1-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 27002680 |
| Molecular Formula | C20H30N4O6S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (3S)-N,N-diethyl-1-(2-morpholin-4-ylsulfonyl-4-nitrophenyl)piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCN(c2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C20H30N4O6S/c1-3-21(4-2)20(25)16-6-5-9-22(15-16)18-8-7-17(24(26)27)14-19(18)31(28,29)23-10-12-30-13-11-23/h7-8,14,16H,3-6,9-13,15H2,1-2H3/t16-/m0/s1 |
| InChIKey | UBVOSIDCHDGDFN-INIZCTEOSA-N |
| XLogP | 1.70 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|