C27H22N6O — CID 117083781
4-(6-anilino-9-phenylpurin-2-yl)-N-cyclopropylbenzamide (PubChem CID 117083781) has the molecular formula C27H22N6O and a molecular weight of 446.51 g/mol. Its IUPAC name is 4-(6-anilino-9-phenylpurin-2-yl)-N-cyclopropylbenzamide.
| Compound Name | 4-(6-anilino-9-phenylpurin-2-yl)-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 117083781 |
| Molecular Formula | C27H22N6O |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-(6-anilino-9-phenylpurin-2-yl)-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccc(-c2nc(Nc3ccccc3)c3ncn(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C27H22N6O/c34-27(30-21-15-16-21)19-13-11-18(12-14-19)24-31-25(29-20-7-3-1-4-8-20)23-26(32-24)33(17-28-23)22-9-5-2-6-10-22/h1-14,17,21H,15-16H2,(H,30,34)(H,29,31,32) |
| InChIKey | VDYMLZVXOFDQCK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |