C30H28N6O2 — CID 117079406
N-cyclopropyl-4-[6-(4-phenoxyanilino)-9-propan-2-ylpurin-2-yl]benzamide (PubChem CID 117079406) has the molecular formula C30H28N6O2 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-cyclopropyl-4-[6-(4-phenoxyanilino)-9-propan-2-ylpurin-2-yl]benzamide.
| Compound Name | N-cyclopropyl-4-[6-(4-phenoxyanilino)-9-propan-2-ylpurin-2-yl]benzamide |
|---|---|
| PubChem CID | 117079406 |
| Molecular Formula | C30H28N6O2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | N-cyclopropyl-4-[6-(4-phenoxyanilino)-9-propan-2-ylpurin-2-yl]benzamide |
| SMILES | CC(C)n1cnc2c(Nc3ccc(Oc4ccccc4)cc3)nc(-c3ccc(C(=O)NC4CC4)cc3)nc21 |
| InChI | InChI=1S/C30H28N6O2/c1-19(2)36-18-31-26-28(32-22-14-16-25(17-15-22)38-24-6-4-3-5-7-24)34-27(35-29(26)36)20-8-10-21(11-9-20)30(37)33-23-12-13-23/h3-11,14-19,23H,12-13H2,1-2H3,(H,33,37)(H,32,34,35) |
| InChIKey | FBKRSCWUENSURX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |