C19H17BrN6 — CID 25053058
N-(4-bromophenyl)-9-propan-2-yl-2-pyridin-3-ylpurin-6-amine (PubChem CID 25053058) has the molecular formula C19H17BrN6 and a molecular weight of 409.29 g/mol. Its IUPAC name is N-(4-bromophenyl)-9-propan-2-yl-2-pyridin-3-ylpurin-6-amine.
| Compound Name | N-(4-bromophenyl)-9-propan-2-yl-2-pyridin-3-ylpurin-6-amine |
|---|---|
| PubChem CID | 25053058 |
| Molecular Formula | C19H17BrN6 |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-(4-bromophenyl)-9-propan-2-yl-2-pyridin-3-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(Nc3ccc(Br)cc3)nc(-c3cccnc3)nc21 |
| InChI | InChI=1S/C19H17BrN6/c1-12(2)26-11-22-16-18(23-15-7-5-14(20)6-8-15)24-17(25-19(16)26)13-4-3-9-21-10-13/h3-12H,1-2H3,(H,23,24,25) |
| InChIKey | KQOZMABNRXFRDT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |