C21H23N7O2S — CID 67359486
4-[2-[(9-propan-2-yl-2-pyridin-3-ylpurin-6-yl)amino]ethyl]benzenesulfonamide (PubChem CID 67359486) has the molecular formula C21H23N7O2S and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-[2-[(9-propan-2-yl-2-pyridin-3-ylpurin-6-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(9-propan-2-yl-2-pyridin-3-ylpurin-6-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67359486 |
| Molecular Formula | C21H23N7O2S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-[2-[(9-propan-2-yl-2-pyridin-3-ylpurin-6-yl)amino]ethyl]benzenesulfonamide |
| SMILES | CC(C)n1cnc2c(NCCc3ccc(S(N)(=O)=O)cc3)nc(-c3cccnc3)nc21 |
| InChI | InChI=1S/C21H23N7O2S/c1-14(2)28-13-25-18-20(26-19(27-21(18)28)16-4-3-10-23-12-16)24-11-9-15-5-7-17(8-6-15)31(22,29)30/h3-8,10,12-14H,9,11H2,1-2H3,(H2,22,29,30)(H,24,26,27) |
| InChIKey | WGIDBERJORQZOI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |