C19H22N8 — CID 59408930
9-propan-2-yl-N-[3-(1H-pyrazol-4-yl)propyl]-2-pyridin-3-ylpurin-6-amine (PubChem CID 59408930) has the molecular formula C19H22N8 and a molecular weight of 362.44 g/mol. Its IUPAC name is 9-propan-2-yl-N-[3-(1H-pyrazol-4-yl)propyl]-2-pyridin-3-ylpurin-6-amine.
| Compound Name | 9-propan-2-yl-N-[3-(1H-pyrazol-4-yl)propyl]-2-pyridin-3-ylpurin-6-amine |
|---|---|
| PubChem CID | 59408930 |
| Molecular Formula | C19H22N8 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 9-propan-2-yl-N-[3-(1H-pyrazol-4-yl)propyl]-2-pyridin-3-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(NCCCc3cn[nH]c3)nc(-c3cccnc3)nc21 |
| InChI | InChI=1S/C19H22N8/c1-13(2)27-12-22-16-18(21-8-3-5-14-9-23-24-10-14)25-17(26-19(16)27)15-6-4-7-20-11-15/h4,6-7,9-13H,3,5,8H2,1-2H3,(H,23,24)(H,21,25,26) |
| InChIKey | WABJSPDRXFOINI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|