C22H25N7O2S — CID 59408944
N-[4-[2-[(9-propan-2-yl-2-pyridin-3-ylpurin-6-yl)amino]ethyl]phenyl]methanesulfonamide (PubChem CID 59408944) has the molecular formula C22H25N7O2S and a molecular weight of 451.56 g/mol. Its IUPAC name is N-[4-[2-[(9-propan-2-yl-2-pyridin-3-ylpurin-6-yl)amino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[(9-propan-2-yl-2-pyridin-3-ylpurin-6-yl)amino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59408944 |
| Molecular Formula | C22H25N7O2S |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[4-[2-[(9-propan-2-yl-2-pyridin-3-ylpurin-6-yl)amino]ethyl]phenyl]methanesulfonamide |
| SMILES | CC(C)n1cnc2c(NCCc3ccc(NS(C)(=O)=O)cc3)nc(-c3cccnc3)nc21 |
| InChI | InChI=1S/C22H25N7O2S/c1-15(2)29-14-25-19-21(26-20(27-22(19)29)17-5-4-11-23-13-17)24-12-10-16-6-8-18(9-7-16)28-32(3,30)31/h4-9,11,13-15,28H,10,12H2,1-3H3,(H,24,26,27) |
| InChIKey | FYQZHIRJPCEQDD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |