C27H22N8OS — CID 45115625
4-[6-(1H-benzimidazol-2-ylmethylamino)-9-thiophen-3-ylpurin-2-yl]-N-cyclopropylbenzamide (PubChem CID 45115625) has the molecular formula C27H22N8OS and a molecular weight of 506.60 g/mol. Its IUPAC name is 4-[6-(1H-benzimidazol-2-ylmethylamino)-9-thiophen-3-ylpurin-2-yl]-N-cyclopropylbenzamide.
| Compound Name | 4-[6-(1H-benzimidazol-2-ylmethylamino)-9-thiophen-3-ylpurin-2-yl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 45115625 |
| Molecular Formula | C27H22N8OS |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 4-[6-(1H-benzimidazol-2-ylmethylamino)-9-thiophen-3-ylpurin-2-yl]-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccc(-c2nc(NCc3nc4ccccc4[nH]3)c3ncn(-c4ccsc4)c3n2)cc1 |
| InChI | InChI=1S/C27H22N8OS/c36-27(30-18-9-10-18)17-7-5-16(6-8-17)24-33-25(28-13-22-31-20-3-1-2-4-21(20)32-22)23-26(34-24)35(15-29-23)19-11-12-37-14-19/h1-8,11-12,14-15,18H,9-10,13H2,(H,30,36)(H,31,32)(H,28,33,34) |
| InChIKey | DFWGYJORGXAXOS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |