C27H19N7S — CID 117082013
N-(1H-benzimidazol-2-ylmethyl)-2-(1-benzothiophen-3-yl)-9-phenylpurin-6-amine (PubChem CID 117082013) has the molecular formula C27H19N7S and a molecular weight of 473.57 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-(1-benzothiophen-3-yl)-9-phenylpurin-6-amine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-(1-benzothiophen-3-yl)-9-phenylpurin-6-amine |
|---|---|
| PubChem CID | 117082013 |
| Molecular Formula | C27H19N7S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-(1-benzothiophen-3-yl)-9-phenylpurin-6-amine |
| SMILES | c1ccc(-n2cnc3c(NCc4nc5ccccc5[nH]4)nc(-c4csc5ccccc45)nc32)cc1 |
| InChI | InChI=1S/C27H19N7S/c1-2-8-17(9-3-1)34-16-29-24-26(28-14-23-30-20-11-5-6-12-21(20)31-23)32-25(33-27(24)34)19-15-35-22-13-7-4-10-18(19)22/h1-13,15-16H,14H2,(H,30,31)(H,28,32,33) |
| InChIKey | ZUDAHRVKOTULTJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |