C26H24N6OS — CID 117090977
1-[2-[2-(1-benzothiophen-3-yl)-6-(benzylamino)purin-9-yl]ethyl]pyrrolidin-2-one (PubChem CID 117090977) has the molecular formula C26H24N6OS and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-[2-[2-(1-benzothiophen-3-yl)-6-(benzylamino)purin-9-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-(1-benzothiophen-3-yl)-6-(benzylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117090977 |
| Molecular Formula | C26H24N6OS |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-[2-[2-(1-benzothiophen-3-yl)-6-(benzylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCn1cnc2c(NCc3ccccc3)nc(-c3csc4ccccc34)nc21 |
| InChI | InChI=1S/C26H24N6OS/c33-22-11-6-12-31(22)13-14-32-17-28-23-25(27-15-18-7-2-1-3-8-18)29-24(30-26(23)32)20-16-34-21-10-5-4-9-19(20)21/h1-5,7-10,16-17H,6,11-15H2,(H,27,29,30) |
| InChIKey | BMVMQZHDXCPWQP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |