C26H30N8O — CID 117079929
1-[2-[6-(benzylamino)-2-[3-(dimethylamino)anilino]purin-9-yl]ethyl]pyrrolidin-2-one (PubChem CID 117079929) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[2-[6-(benzylamino)-2-[3-(dimethylamino)anilino]purin-9-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[6-(benzylamino)-2-[3-(dimethylamino)anilino]purin-9-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117079929 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 1-[2-[6-(benzylamino)-2-[3-(dimethylamino)anilino]purin-9-yl]ethyl]pyrrolidin-2-one |
| SMILES | CN(C)c1cccc(Nc2nc(NCc3ccccc3)c3ncn(CCN4CCCC4=O)c3n2)c1 |
| InChI | InChI=1S/C26H30N8O/c1-32(2)21-11-6-10-20(16-21)29-26-30-24(27-17-19-8-4-3-5-9-19)23-25(31-26)34(18-28-23)15-14-33-13-7-12-22(33)35/h3-6,8-11,16,18H,7,12-15,17H2,1-2H3,(H2,27,29,30,31) |
| InChIKey | NXYQUDJTCRIHHJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |