C24H25N7O — CID 117081764
1-[2-[2-(3-aminophenyl)-6-(benzylamino)purin-9-yl]ethyl]pyrrolidin-2-one (PubChem CID 117081764) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-[2-[2-(3-aminophenyl)-6-(benzylamino)purin-9-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-(3-aminophenyl)-6-(benzylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117081764 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-[2-[2-(3-aminophenyl)-6-(benzylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
| SMILES | Nc1cccc(-c2nc(NCc3ccccc3)c3ncn(CCN4CCCC4=O)c3n2)c1 |
| InChI | InChI=1S/C24H25N7O/c25-19-9-4-8-18(14-19)22-28-23(26-15-17-6-2-1-3-7-17)21-24(29-22)31(16-27-21)13-12-30-11-5-10-20(30)32/h1-4,6-9,14,16H,5,10-13,15,25H2,(H,26,28,29) |
| InChIKey | VAUQWGPIENSNCM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|