C25H27N7O3 — CID 117082665
1-[2-[2-(6-methoxy-3-pyridinyl)-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one (PubChem CID 117082665) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 1-[2-[2-(6-methoxy-3-pyridinyl)-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-(6-methoxy-3-pyridinyl)-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117082665 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 1-[2-[2-(6-methoxy-3-pyridinyl)-6-(2-phenoxyethylamino)purin-9-yl]ethyl]pyrrolidin-2-one |
| SMILES | COc1ccc(-c2nc(NCCOc3ccccc3)c3ncn(CCN4CCCC4=O)c3n2)cn1 |
| InChI | InChI=1S/C25H27N7O3/c1-34-20-10-9-18(16-27-20)23-29-24(26-11-15-35-19-6-3-2-4-7-19)22-25(30-23)32(17-28-22)14-13-31-12-5-8-21(31)33/h2-4,6-7,9-10,16-17H,5,8,11-15H2,1H3,(H,26,29,30) |
| InChIKey | SYMQYGNTAOCYBJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|