C17H22N6O3 — CID 117083958
1-[3-[[4-methoxy-6-(6-methoxy-3-pyridinyl)-1,3,5-triazin-2-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117083958) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-[3-[[4-methoxy-6-(6-methoxy-3-pyridinyl)-1,3,5-triazin-2-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[4-methoxy-6-(6-methoxy-3-pyridinyl)-1,3,5-triazin-2-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117083958 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-[3-[[4-methoxy-6-(6-methoxy-3-pyridinyl)-1,3,5-triazin-2-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | COc1ccc(-c2nc(NCCCN3CCCC3=O)nc(OC)n2)cn1 |
| InChI | InChI=1S/C17H22N6O3/c1-25-13-7-6-12(11-19-13)15-20-16(22-17(21-15)26-2)18-8-4-10-23-9-3-5-14(23)24/h6-7,11H,3-5,8-10H2,1-2H3,(H,18,20,21,22) |
| InChIKey | FLBUEADYDROTQK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|