C21H27N7O2 — CID 117092163
1-[3-[[8-(6-methoxy-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117092163) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-[3-[[8-(6-methoxy-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[8-(6-methoxy-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117092163 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-[3-[[8-(6-methoxy-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | COc1ccc(-c2nc3c(NCCCN4CCCC4=O)ncnc3n2C(C)C)cn1 |
| InChI | InChI=1S/C21H27N7O2/c1-14(2)28-20(15-7-8-16(30-3)23-12-15)26-18-19(24-13-25-21(18)28)22-9-5-11-27-10-4-6-17(27)29/h7-8,12-14H,4-6,9-11H2,1-3H3,(H,22,24,25) |
| InChIKey | FXOSOBXFUKSRJQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|