C19H22N4O3 — CID 117083693
2-(6-methoxy-3-pyridinyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-4-carboxamide (PubChem CID 117083693) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-4-carboxamide.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 117083693 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCCN3CCCC3=O)ccn2)cn1 |
| InChI | InChI=1S/C19H22N4O3/c1-26-17-6-5-15(13-22-17)16-12-14(7-9-20-16)19(25)21-8-3-11-23-10-2-4-18(23)24/h5-7,9,12-13H,2-4,8,10-11H2,1H3,(H,21,25) |
| InChIKey | RRUVFGXTEODGFG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|