C19H20N6O2 — CID 122562091
N-[3-(2-oxopyrrolidin-1-yl)propyl]-4-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)benzamide (PubChem CID 122562091) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-4-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)benzamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-4-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)benzamide |
|---|---|
| PubChem CID | 122562091 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-4-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)benzamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1ccc(-c2cnc3ncnn3c2)cc1 |
| InChI | InChI=1S/C19H20N6O2/c26-17-3-1-9-24(17)10-2-8-20-18(27)15-6-4-14(5-7-15)16-11-21-19-22-13-23-25(19)12-16/h4-7,11-13H,1-3,8-10H2,(H,20,27) |
| InChIKey | JTESIQOFKAWPCN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|