C18H22N6O2 — CID 122569048
3-(2,6-diaminopyrimidin-4-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide (PubChem CID 122569048) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-(2,6-diaminopyrimidin-4-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide.
| Compound Name | 3-(2,6-diaminopyrimidin-4-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 122569048 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-(2,6-diaminopyrimidin-4-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
| SMILES | Nc1cc(-c2cccc(C(=O)NCCCN3CCCC3=O)c2)nc(N)n1 |
| InChI | InChI=1S/C18H22N6O2/c19-15-11-14(22-18(20)23-15)12-4-1-5-13(10-12)17(26)21-7-3-9-24-8-2-6-16(24)25/h1,4-5,10-11H,2-3,6-9H2,(H,21,26)(H4,19,20,22,23) |
| InChIKey | DYBUHPJTAIDULD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|