C19H21N3O3 — CID 122570247
3-(5-hydroxy-2-pyridinyl)-N-[2-(2-oxopiperidin-1-yl)ethyl]benzamide (PubChem CID 122570247) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-(5-hydroxy-2-pyridinyl)-N-[2-(2-oxopiperidin-1-yl)ethyl]benzamide.
| Compound Name | 3-(5-hydroxy-2-pyridinyl)-N-[2-(2-oxopiperidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 122570247 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-(5-hydroxy-2-pyridinyl)-N-[2-(2-oxopiperidin-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCN1CCCCC1=O)c1cccc(-c2ccc(O)cn2)c1 |
| InChI | InChI=1S/C19H21N3O3/c23-16-7-8-17(21-13-16)14-4-3-5-15(12-14)19(25)20-9-11-22-10-2-1-6-18(22)24/h3-5,7-8,12-13,23H,1-2,6,9-11H2,(H,20,25) |
| InChIKey | PRMJIRKHBOCSAV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |